Bicalutamide
Nonsteroidal antiandrogen used primarily in the treatment of prostate cancer. Bicalutamide competitively inhibits androgen binding to the androgen receptor, suppressing androgen-dependent signaling and growth of prostate cancer cells
CAS Number: 90357-06-5
Molecular Mass: 430.38 g/mol
Formula: C18H14F4N2O4S
Smiles: N#CC1=CC=C(C=C1C(F)(F)F)NC(=O)C(O)(C)CS(=O)(=O)C2=CC=C(F)C=C2
Synonymes:
Bicalutamide, Propanamide, N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methyl-, Propanamide, N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methyl-, (±)-, N-[4-Cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide, ICI 176334, Casodex, (±)-4′-Cyano-α,α,α-trifluoro-3-[(p-fluorophenyl)sulfonyl]-2-methyl-m-lactotoluidide, Cosudex, ZD 176334, Casode
Bioactivity: Androgen receptor antagonist; nonsteroidal antiandrogen; antineoplastic agent
Solubility in Different Solvents
| Solvent | Temperature [K] | Crystal form | Solubility [mg/mL] | Reference |
|---|---|---|---|---|
| 1-Butanol | 278.15 | - | 1.545 | [349] |
| 1-Butanol | 283.15 | - | 1.818 | [349] |
| 1-Butanol | 288.15 | - | 2.143 | [349] |
| 1-Butanol | 293.15 | - | 2.581 | [349] |
| 1-Butanol | 298.15 | - | 3.047 | [349] |
| 1-Butanol | 303.15 | - | 3.653 | [349] |
| 1-Butanol | 308.15 | - | 4.319 | [349] |
| 1-Butanol | 313.15 | - | 5.061 | [349] |
| 1-Butanol | 318.15 | - | 5.851 | [349] |
| 1-Octanol | 293.15 | Form I | 0.61 | [6] |
| 1-Octanol | 298.15 | Form I | 0.7 | [6] |
| 1-Octanol | 303.15 | Form I | 0.81 | [6] |
| 1-Octanol | 308.15 | Form I | 0.91 | [6] |
| 1-Octanol | 313.15 | Form I | 1.06 | [6] |
| 1-Propanol | 278.15 | - | 1.744 | [349] |
| 1-Propanol | 283.15 | - | 2.038 | [349] |
| 1-Propanol | 288.15 | - | 2.406 | [349] |
| 1-Propanol | 293.15 | - | 2.811 | [349] |
| 1-Propanol | 298.15 | - | 3.295 | [349] |
| 1-Propanol | 303.15 | - | 3.865 | [349] |
| 1-Propanol | 308.15 | - | 4.441 | [349] |
| 1-Propanol | 313.15 | - | 5.133 | [349] |
| 1-Propanol | 318.15 | - | 5.942 | [349] |
| Acetonitrile | 278.15 | - | 22.99 | [349] |
| Acetonitrile | 283.15 | - | 26.93 | [349] |
| Acetonitrile | 288.15 | - | 31.17 | [349] |
| Acetonitrile | 293.15 | - | 35.73 | [349] |
| Acetonitrile | 298.15 | - | 40.37 | [349] |
| Acetonitrile | 303.15 | - | 45.61 | [349] |
| Acetonitrile | 308.15 | - | 51.99 | [349] |
| Acetonitrile | 313.15 | - | 58.59 | [349] |
| Acetonitrile | 318.15 | - | 66.37 | [349] |
| Cyclohexane | 288.15 | - | 0.0024 | [349] |
| Cyclohexane | 293.15 | - | 0.0035 | [349] |
| Cyclohexane | 298.15 | - | 0.0051 | [349] |
| Cyclohexane | 303.15 | - | 0.0071 | [349] |
| Cyclohexane | 308.15 | - | 0.0096 | [349] |
| Cyclohexane | 313.15 | - | 0.0128 | [349] |
| Cyclohexane | 318.15 | - | 0.0169 | [349] |
| Ethanol | 278.15 | - | 3.501 | [349] |
| Ethanol | 283.15 | - | 4.059 | [349] |
| Ethanol | 288.15 | - | 4.665 | [349] |
| Ethanol | 293.15 | Form I | 8.4 | [6] |
| Ethanol | 293.15 | - | 5.361 | [349] |
| Ethanol | 298.15 | Form I | 10.29 | [6] |
| Ethanol | 298.15 | - | 6.163 | [349] |
| Ethanol | 303.15 | Form I | 12.51 | [6] |
| Ethanol | 303.15 | - | 7.005 | [349] |
| Ethanol | 308.15 | Form I | 15.04 | [6] |
| Ethanol | 308.15 | - | 7.995 | [349] |
| Ethanol | 313.15 | Form I | 17.18 | [6] |
| Ethanol | 313.15 | - | 9.05 | [349] |
| Ethanol | 318.15 | - | 10.31 | [349] |
| Ethyl acetate | 278.15 | - | 6.443 | [349] |
| Ethyl acetate | 283.15 | - | 8.319 | [349] |
| Ethyl acetate | 288.15 | - | 10.77 | [349] |
| Ethyl acetate | 293.15 | - | 13.47 | [349] |
| Ethyl acetate | 298.15 | - | 16.81 | [349] |
| Ethyl acetate | 303.15 | - | 20.32 | [349] |
| Ethyl acetate | 308.15 | - | 23.81 | [349] |
| Ethyl acetate | 313.15 | - | 28.11 | [349] |
| Ethyl acetate | 318.15 | - | 32.67 | [349] |
| Hexane | 288.15 | - | 0.0013 | [349] |
| Hexane | 293.15 | Form I | 0.0024 | [6] |
| Hexane | 293.15 | - | 0.0019 | [349] |
| Hexane | 298.15 | Form I | 0.0035 | [6] |
| Hexane | 298.15 | - | 0.0027 | [349] |
| Hexane | 303.15 | Form I | 0.0049 | [6] |
| Hexane | 303.15 | - | 0.0038 | [349] |
| Hexane | 308.15 | Form I | 0.0066 | [6] |
| Hexane | 308.15 | - | 0.0051 | [349] |
| Hexane | 313.15 | Form I | 0.0089 | [6] |
| Hexane | 313.15 | - | 0.007 | [349] |
| Hexane | 318.15 | Form I | 0.0115 | [6] |
| Hexane | 318.15 | - | 0.0094 | [349] |
| Isobutanol | 278.15 | - | 1.081 | [349] |
| Isobutanol | 283.15 | - | 1.297 | [349] |
| Isobutanol | 288.15 | - | 1.546 | [349] |
| Isobutanol | 293.15 | - | 1.818 | [349] |
| Isobutanol | 298.15 | - | 2.131 | [349] |
| Isobutanol | 303.15 | - | 2.526 | [349] |
| Isobutanol | 308.15 | - | 2.985 | [349] |
| Isobutanol | 313.15 | - | 3.538 | [349] |
| Isobutanol | 318.15 | - | 4.168 | [349] |
| Isopropanol | 278.15 | - | 1.476 | [349] |
| Isopropanol | 283.15 | - | 1.803 | [349] |
| Isopropanol | 288.15 | - | 2.215 | [349] |
| Isopropanol | 293.15 | - | 2.646 | [349] |
| Isopropanol | 298.15 | - | 3.113 | [349] |
| Isopropanol | 303.15 | - | 3.637 | [349] |
| Isopropanol | 308.15 | - | 4.191 | [349] |
| Isopropanol | 313.15 | - | 4.761 | [349] |
| Isopropanol | 318.15 | - | 5.406 | [349] |
| Methanol | 278.15 | - | 8.971 | [349] |
| Methanol | 283.15 | - | 10.96 | [349] |
| Methanol | 288.15 | - | 13.04 | [349] |
| Methanol | 293.15 | - | 15.27 | [349] |
| Methanol | 298.15 | - | 17.76 | [349] |
| Methanol | 303.15 | - | 20.36 | [349] |
| Methanol | 308.15 | - | 23.2 | [349] |
| Methanol | 313.15 | - | 26.3 | [349] |
| Methanol | 318.15 | - | 29.75 | [349] |
| Propyl acetate | 278.15 | - | 15.13 | [349] |
| Propyl acetate | 283.15 | - | 17.53 | [349] |
| Propyl acetate | 288.15 | - | 20.11 | [349] |
| Propyl acetate | 293.15 | - | 22.83 | [349] |
| Propyl acetate | 298.15 | - | 25.9 | [349] |
| Propyl acetate | 303.15 | - | 29.51 | [349] |
| Propyl acetate | 308.15 | - | 33.86 | [349] |
| Propyl acetate | 313.15 | - | 38.82 | [349] |
| Propyl acetate | 318.15 | - | 44.58 | [349] |
| Toluene | 278.15 | - | 0.2027 | [349] |
| Toluene | 283.15 | - | 0.2439 | [349] |
| Toluene | 288.15 | - | 0.2988 | [349] |
| Toluene | 293.15 | - | 0.3618 | [349] |
| Toluene | 298.15 | - | 0.4375 | [349] |
| Toluene | 303.15 | - | 0.5156 | [349] |
| Toluene | 308.15 | - | 0.5969 | [349] |
| Toluene | 313.15 | - | 0.6859 | [349] |
| Toluene | 318.15 | - | 0.7779 | [349] |
| Water | 298.15 | Form I | 0.0027 | [6] |
| Water | 303.15 | Form I | 0.0035 | [6] |
| Water | 308.15 | Form I | 0.0045 | [6] |
| Water | 313.15 | Form I | 0.0056 | [6] |
| Water | 318.15 | Form I | 0.007 | [6] |
Thermodynamic parameters of solution
| Solvent | Temperature [K] | Crystal form | ΔHsol [kJ/mol] | ΔSsol [J/mol/K] | ΔGsol [kJ/mol] | Reference |
|---|---|---|---|---|---|---|
| 1-Octanol | 298.15 | Form I | 21.6 | 3.73 | 20.49 | [6] |
| Ethanol | 298.15 | Form I | 28.9 | 42.43 | 16.2 | [6] |
| Hexane | 303.15 | Form I | 49.2 | 50.7 | 34.2 | [6] |
| Water | 303.15 | Form I | 36.8 | -7.37 | 39.0 | [6] |
Phase transitions
| Transition type | Temperature [K] | Crystal form | ΔH [kJ/mol] | ΔS [J/mol/K] | ΔG [kJ/mol] | Reference |
|---|---|---|---|---|---|---|
| Melting | 465.5 | Form I | - | - | - | [6] |
| Sublimation | 298.15 | Form I | 124.7 | 205.0 | 63.7 | [11] |
Molecule 3D descriptors
| Descriptor | Value |
|---|---|
| PMI1 | 1329.3400 |
| PMI2 | 9360.8756 |
| PMI3 | 10075.8120 |
| NPR1 | 0.1319 |
| NPR2 | 0.9290 |
| RadiusOfGyration | 4.9117 |
| InertialShapeFactor | 0.0007 |
| Eccentricity | 0.9913 |
| Asphericity | 0.6563 |
| SpherocityIndex | 0.1580 |
| PBF | 0.8408 |