Lornoxicam
Nonsteroidal anti-inflammatory drug (NSAID) of the oxicam class used for the treatment of pain and inflammation, including inflammatory joint diseases and osteoarthritis. It inhibits COX-1 and COX-2 and thereby reduces prostaglandin production
CAS Number: 70374-39-9
Molecular Mass: 371.8 g/mol
Formula: C13H10ClN3O4S2
Smiles: CN1C(C(=O)Nc2ccccn2)=C(O)c2sc(Cl)cc2S1(=O)=O
Synonymes:
Lornoxicam, 70374-39-9, Chlortenoxicam, Xefocam, Xefo, Lorcam, Lornoxicamum, Ro 13-9297, CCRIS 8589, NSC-759620, Ro-13-9297, ER09126G7A, Ro-139297, 2H-THIENO[2,3-E]-1,2-THIAZINE-3-CARBOXAMIDE, 6-CHLORO-4-HYDROXY-2-METHYL-N-2-PYRIDINYL-, 1,1-DIOXIDE, CHEBI:31783, 2H-Thieno(2,3-e)-1,2-thiazine-3-carboxamide, 6-chloro-4-hydroxy-2-methyl-N-2-pyridinyl-, 1,1-dioxide, RefChem:800048, M01AC05, 6-chloro-4-hydroxy-2-methyl-1,1-dioxo-N-(pyridin-2-yl)-2H-1??-thieno(2,3-e)(1,2)thiazine-3-carboxamide, DTXCID4026133, DTXSID6046133, Lornoxicamum [INN-Latin], Taigalor, Safem, Telos, Lorcam (TN), CLTX, MFCD00866163, C13H10ClN3O4S2, 6-chloro-4-hydroxy-2-methyl-N-(pyridin-2-yl)-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide 1,1-dioxide, Lornoxicam (Xefo), 6-chloro-4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-ylthieno[2,3-e]thiazine-3-carboxamide, Chlortenoxicam, Ro 13-9297, TS110, 6-Chloro-4-hydroxy-2-methyl-N-2-pyridinyl-2H-thieno[2,3-e]-1,2-thiazine-3-carboxamide 1,1-Dioxide, 6-chloro-4-hydroxy-2-methyl-N-pyridin-2-yl-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide 1,1-dioxide, 70374-27-5, SMR000550483, Lornoxicam [USAN:INN:BAN], BRN 1039965, UNII-ER09126G7A, Lornoxicam (Standard), LORNOXICAM [MI], LORNOXICAM [INN], LORNOXICAM [JAN], LORNOXICAM [USAN], LORNOXICAM [MART.], LORNOXICAM [WHO-DD], SCHEMBL35101, SCHEMBL35102, 6-Chloro-4-hydroxy-2-methyl-N-2-pyridyl-2H-thieno(2,3-e)-1,2-thiazine-3-carboxamide 1,1-dioxide, MLS001165721, MLS001304721, MLS006010084, orb1308547, orb3025392, SCHEMBL1650239, SCHEMBL6881779, CHEMBL1569487, CHEMBL3188235, Lornoxicam (JP18/USAN/INN), Lornoxicam, >=98% (HPLC), SCHEMBL29353228, SCHEMBL30649134, BDBM92331, HY-B0367R, HMS2231B07, HMS3264I20, HMS3655N13, HMS3887C17, HMS5087P15, Pharmakon1600-01502302, ALBB-014101, HY-B0367, MSK10340, EBC-03924, NSC759620, s2047, SBB056363, STL504715, TS-110, AKOS000281810, AKOS021982478, AKOS026750113, AB07518, AC-4675, CCG-213023, DB06725, FL24940, KS-1080, NSC 759620, NCGC00246566-01, NCGC00346667-01, NCGC00346667-02, 6-chloro-4-hydroxy-2-methyl-3-(2-pyridylcarbamoyl)-2H-thieno[2,3-e]-1,2-thiazine-1,1-dioxide, HN-10000, SY051041, L0239, NS00004372, SW220125-1, C76243, D01866, SBI-0653409.0001, AB00876293_04, AB00876293_06, EN300-6488763, F069199, SR-01000799148, Q2734874, SR-01000799148-3, Z2235801980, 6-chloro-4-hydroxy-2-methyl-1,1-dioxo-N-(2-pyridyl)thieno[2,3-e]thiazine-3-carboxamide, (3E)-6-chloro-3-[hydroxy(pyridin-2-ylamino)methylene]- 2-methyl-2,3-dihydro-4H-thieno[2,3-e][1,2] thiazin- 4 - one 1,1-dioxide, (3e)-6-chloro-3-[hydroxyl(pyridin-2-ylamino)methylene]-2-methyl-2,3-dihydro-4h-thieno[2,3-e][1,2]thiazin-4-one 1,1-dioxide, (6-chloro-4-hydroxy-2-methyl-1,1-dioxothiopheno[2,3-e]1,2-thiazin-3-yl)-N-(2-p yridyl)carboxamide, 2H-Thieno(3,2-e)-1,2-thiazine-3-carboxamide, 6-chloro-4-hydroxy-2-methyl-N-2-pyridinyl-, 1,1-dioxide, 6-chloro-4-hydroxy-2-methyl-1,1-dioxo-N-(pyridin-2-yl)-2H-1|E?-thieno[2,3-e][1,2]thiazine-3-carboxamide, 6-chloro-4-hydroxy-2-methyl-1,1-dioxo-N-(pyridin-2-yl)-2H-1lambda6-thieno[2,3-e][1,2]thiazine-3-carboxamide, 6-Chloro-4-hydroxy-2-methyl-N-(2-pyridyl)-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide 1,1-Dioxide, 6-chloro-4-hydroxy-2-methyl-N-(pyridin-2-yl)-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide1,1-dioxide, 6-Chloro-4-hydroxy-2-methyl-N-pyridin-2-yl-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide 1,1-dioxide (Lornoxicam), 6-Chloro-4-hydroxy-2-methyl-N-pyridin-2-yl-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide-1,1-dioxide
Bioactivity: COX-1 and COX-2 inhibitor; NSAID
Solubility in Different Solvents
| Solvent | Temperature [K] | Crystal form | Solubility [mg/mL] | Reference |
|---|---|---|---|---|
| 1-Butanol | 298.15 | - | 0.05497 | [26] |
| 1-Butanol | 303.15 | - | 0.06236 | [26] |
| 1-Butanol | 308.15 | - | 0.07007 | [26] |
| 1-Butanol | 313.15 | - | 0.0793 | [26] |
| 1-Butanol | 323.15 | - | 0.09432 | [26] |
| 2-Butanol | 298.15 | - | 0.1203 | [26] |
| 2-Butanol | 303.15 | - | 0.1437 | [26] |
| 2-Butanol | 308.15 | - | 0.1668 | [26] |
| 2-Butanol | 313.15 | - | 0.1893 | [26] |
| 2-Butanol | 323.15 | - | 0.2576 | [26] |
| Diethylene Glycol Monoethyl Ether | 298.15 | - | 0.8639 | [26] |
| Diethylene Glycol Monoethyl Ether | 303.15 | - | 1.036 | [26] |
| Diethylene Glycol Monoethyl Ether | 308.15 | - | 1.248 | [26] |
| Diethylene Glycol Monoethyl Ether | 313.15 | - | 1.484 | [26] |
| Diethylene Glycol Monoethyl Ether | 323.15 | - | 1.979 | [26] |
| Ethanol | 298.15 | - | 0.0824 | [25] |
| Ethanol | 298.15 | - | 0.0534 | [26] |
| Ethanol | 303.15 | - | 0.07311 | [26] |
| Ethanol | 308.15 | - | 0.09086 | [26] |
| Ethanol | 313.15 | - | 0.1234 | [26] |
| Ethanol | 323.15 | - | 0.1983 | [26] |
| Ethyl acetate | 298.15 | - | 0.3167 | [26] |
| Ethyl acetate | 303.15 | - | 0.3404 | [26] |
| Ethyl acetate | 308.15 | - | 0.3671 | [26] |
| Ethyl acetate | 313.15 | - | 0.3955 | [26] |
| Ethyl acetate | 323.15 | - | 0.4409 | [26] |
| Ethylene Glycol | 298.15 | - | 1.489 | [26] |
| Ethylene Glycol | 303.15 | - | 2.214 | [26] |
| Ethylene Glycol | 308.15 | - | 3.132 | [26] |
| Ethylene Glycol | 313.15 | - | 4.177 | [26] |
| Ethylene Glycol | 323.15 | - | 7.073 | [26] |
| Isopropanol | 298.15 | - | 0.04373 | [26] |
| Isopropanol | 303.15 | - | 0.05576 | [26] |
| Isopropanol | 308.15 | - | 0.06932 | [26] |
| Isopropanol | 313.15 | - | 0.08602 | [26] |
| Isopropanol | 323.15 | - | 0.1254 | [26] |
| Propylene Glycol | 298.15 | - | 0.16 | [26] |
| Propylene Glycol | 303.15 | - | 0.181 | [26] |
| Propylene Glycol | 308.15 | - | 0.203 | [26] |
| Propylene Glycol | 313.15 | - | 0.225 | [26] |
| Propylene Glycol | 323.15 | - | 0.2677 | [26] |
| Water | 298.15 | - | 0.062 | [25] |
| Water | 298.15 | - | 0.05988 | [26] |
| Water | 298.15 | - | 0.0597 | [27] |
| Water | 303.15 | - | 0.08466 | [26] |
| Water | 303.15 | - | 0.0845 | [27] |
| Water | 308.15 | - | 0.1132 | [26] |
| Water | 308.15 | - | 0.1153 | [27] |
| Water | 313.15 | - | 0.1489 | [26] |
| Water | 313.15 | - | 0.1517 | [27] |
| Water | 323.15 | - | 0.2427 | [26] |
| Water | 323.15 | - | 0.245 | [27] |
Molecule 3D descriptors
| Descriptor | Value |
|---|---|
| PMI1 | 946.5197 |
| PMI2 | 5084.1112 |
| PMI3 | 5712.6351 |
| NPR1 | 0.1657 |
| NPR2 | 0.8900 |
| RadiusOfGyration | 3.9738 |
| InertialShapeFactor | 0.0009 |
| Eccentricity | 0.9862 |
| Asphericity | 0.5835 |
| SpherocityIndex | 0.1307 |
| PBF | 0.6795 |