Progesterone
CAS Number: 57-83-0
Molecular Mass: 314.5 g/mol
Formula: C21H30O2
Smiles: CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C
Synonymes:
Progesterone, progesterone, 57-83-0, Pregn-4-ene-3,20-dione, Agolutin, Crinone, Progestin, Utrogestan, Luteol, 4-Pregnene-3,20-dione, Gestormone, Glanducorpin, Prometrium, Syngesterone, Corlutin, Cyclogest, Gestone, Corlutina, Corluvite, Flavolutan, Fologenon, Gynolutone, Hormoflaveine, Hormoluton, Lucorteum, Luteostab, Lutociclina, Lutocyclin, Pregnenedione, Progestasert, Progesterol, Progesteronum, Progestone, Progestron, Corporin, Gesterol, Gestron, Gynlutin, Luteodyn, Luteogan, Luteopur, Luteosan, Luteovis, Lutidon, Nalutron, Lutin, Lutocyclin M, Bio-luton, Lipo-Lutin, Luteocrin normale, Methylpregnone, Progestosol, Progestronol, Syngestrets, Lingusorbs, Luteinique, Lutocylin, Lutoform, Lutogyl, Lutromone, Membrettes, Piaponon, Primolut, Progekan, Prolets, Prolidon, Proluton, Protormone, Syntolutan, Lutren, Lucorteum Sol, Prochieve, Prolutone, Synovex S, Endometrin, Gesterol 100, Gynoluton, Projestaject, 17alpha-Progesterone, Percutacrine Luteinique, Progeston, Pregnene-3,20-dione, Akrolutin, Gestiron, Progestogel, 3,20-Pregnene-4, (S)-Progesterone, Progesteron, Lutocylol, Progestol, Luteum, Crinone progesterone gel, Gelbkoerperhormon, NSC-9704, Progesterona, Vitarrine, (S)-4-Pregnene-3,20-dione, Delta(4)-pregnene-3,20-dione, (S)-Pregn-4-en-3,20-dione, beta-Progesterone, Lutogynon, Progesterone, micronized, DTXSID3022370, 17alpha-Hydroxy-6alpha-methylpregn-4-ene-3,20-dione, NSC-64377, MILPROSA, 4G7DS2Q64Y, CHEBI:17026, NSC9704, delta(Sup4)-pregnene-3,20-dione, (8S,9S,10R,13S,14S,17S)-17-Acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one, NSC64377, U 3672, DTXCID902370, Natural Progesterone, delta4-Pregnene-3,20-dione, Syngestrone, Lutigest, Progesta-care, Progesto-Life, Lutocylin M, Progesterone Combo, Serenity for women, Progesterone Phenolic, Synthetic Progestagen, Progesterone 1538, (8S,9S,10R,13S,14S,17S)-17-Acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta(a)phenanthren-3-one, RefChem:6165, Therapeutic Progesterone, P25 Progesterone Cream, P50 Progesterone Cream, P75 Progesterone Cream, EAZI-BREED CIDR Sheep, EAZI-BREED CIDR Cattle, P75 Lav Progesterone Cream, Advanced Formula Progesto-Life, CHEBI:59826, EAZI-BREED CIDR Sheep Insert, EAZI-BREED CIDR Cattle Insert, G03DA04, DTXCID801775313, P75 Maxx with Retinol All Natural Progesterone 75 Cream, (1S,2R,10S,11S,14S,15S)-14-acetyl-2,15-dimethyltetracyclo(8.7.0.02,7.011,15)heptadec-6-en-5-one, 200-350-6, DTXSID001346637, Lutex, Gesterol 50, Colprosterone, Cyclogesterin, Prolutin, Lugesteron, Lutocuclin M, Luteol (VAN), .beta.-Progesterone, Percutacrine, Progeffik, Utrogest, Estima, Progesteronum [INN-Latin], Progesterona [INN-Spanish], delta(sup 4)-Pregnene-3,20-dione, C21H30O2, CCRIS 533, Prontogest, 17.alpha.-Progesterone, HSDB 3389, Progesterone [Progestins], 4-Pregnen-3,20-dione, AI3-51682, Prometrium (TN), Pregn-4-en-3,20-dione, MFCD00003658, Crinone (TN), 6alpha-Methylpregn-4-en-17alpha-ol-3,20-dione, .delta.4-Pregnene-3,20-dione, Progesterone (Standard), Pregn-4-ene-3,20-dione, 17alpha-hydroxy-6alpha-methyl-, component of Cyclogesterin, .delta.(sup4)-Pregnene-3,20-dione, CHEMBL103, D4-Pregnene-3,20-dione, MLS000028517, (8S,9S,10R,13S,14S,17S)-17-Acetyl-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one, NCGC00015785-04, SMR000058345, 6.alpha.-Methylpregn-4-en-17.alpha.-ol-3,20-dione, 17.alpha.-Hydroxy-6.alpha.-methylpregn-4-ene-3,20-dione, 17a-Progesterone, Duraprogen, Pregesterone, Progestan, Pregn-4-ene-3,20-dione, 17.alpha.-hydroxy-6.alpha.-methyl-, (1S,10S,11S,14S,15S,2R)-14-acetyl-2,15-dimethyl-5-oxotetracyclo[8.7.0.0<2,7>.0 <11,15>]heptadec-6-ene, SMR000653542, CIDR, Progesterone (Prometrium), WLN: L E5 B666 OV MUTJ A1 E1 FV1, SR-01000000088, SR-01000076054, NSC 9704, EINECS 200-350-6, NSC 64377, Pregn-4-ene-3, 17.alpha.-hydroxy-6.alpha.-methyl-, BHR-100, UNII-4G7DS2Q64Y, Progestrel, Lipolutin, Lutinus, Progesterone RS, Progesterone CRS, 1dbb, CAS-57-83-0, Progesterone [USP:INN:BAN:JAN], racemic progesterone, Prestwick_411, Progesterone solution, mpp22, 2aa6, 4bb2, Opera_ID_292, Progesterone, >=99%, Prestwick0_000477, Prestwick1_000477, Prestwick2_000477, Prestwick3_000477, Spectrum5_002053, PROGESTERONE [MI], Cyclogesterin (Salt/Mix), PROGESTERONE [INN], PROGESTERONE [JAN], bmse000482, Epitope ID:116051, EC 200-350-6, PROGESTERONE [HSDB], SCHEMBL7671, ?4-Pregnene-3,20-dione, PROGESTERONE [VANDF], BIDD:PXR0094, Lopac0_000895, BSPBio_000614, PROGESTERONE [MART.], HUMAN SERUM (progesterone), MLS000758277, MLS001074187, MLS001423982, MLS002222367, BIDD:ER0547, P0130_SIGMA, PROGESTERONE [USP-RS], PROGESTERONE [WHO-DD], PROGESTERONE [WHO-IP], SPBio_002553, .delta.-Pregnene-3,20-dione, BDBM8903, BPBio1_000676, GTPL2377, Hydroxyprogesterone Caproic acid, orb1310573, orb3025169, SCHEMBL7610853, SCHEMBL8711607, HY-N0437R, Progesterone (JP18/USP/INN), BHR-310, ETI-411, MSK2223, PROGESTERONE [GREEN BOOK], 1a28, 1h60, HMS1569O16, HMS2051O05, HMS2090J07, HMS2096O16, HMS2230F23, HMS2233P11, HMS3262D12, HMS3713O16, Pregnene, 3,20-dione-delta^4-, PROGESTERONE [ORANGE BOOK], PROGESTERONE [EP MONOGRAPH], Progesterone in human serum (high), BIJUVA COMPONENT PROGESTERONE, HY-N0437, PROGESTERONE [USP MONOGRAPH], Tox21_113157, Tox21_201792, Tox21_300307, Tox21_500895, AC-700, CMC_13406, EBC-06111, LMST02030159, MSK2223-100A, Progesterone, 1mg/ml in Acetonitrile, PROGESTERONUM [WHO-IP LATIN], s1705, SBB012538, AKOS015894908, MSK2223-1000A, Progesterone, 4-Pregnene-3,20-dione, CCG-100766, CS-1937, DB00396, DR-2011, FD12045, FP27173, LP00895, NC00016, SDCCGSBI-0050870.P002, Progesterone 1.0 mg/ml in Acetonitrile, NCGC00022185-03, NCGC00022185-04, NCGC00022185-05, NCGC00022185-06, NCGC00022185-07, NCGC00022185-08, NCGC00022185-09, NCGC00022185-10, NCGC00022185-11, NCGC00022185-12, NCGC00022185-14, NCGC00022185-21, NCGC00090798-01, NCGC00090798-02, NCGC00254120-01, NCGC00259341-01, NCGC00261580-01, (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-3H-cyclopenta[a]phenanthren-3-one, AS-12660, CPD000058345, NCI60_042166, ST069329, FE-999913, CS-0694805, EU-0100895, NS00010899, P0478, T0478, (14beta,17alpha)-pregn-4-ene-3,20-dione, Progesterone, meets USP testing specifications, Progesterone, Vetec(TM) reagent grade, 98%, C00410, D00066, P 0130, Q26963, S00293, Progesterone Solution in Acetonitrile, 100ug/mL, Progesterone, VETRANAL(TM), analytical standard, F374675, Progesterone Solution in Acetonitrile, 1000ug/mL, SR-01000000088-5, SR-01000000088-6, SR-01000076054-1, SR-01000076054-4, BRD-K64994968-001-03-6, 32104FB6-BF81-4F6E-83C2-024DEEAEB272, Z1501485353, Progesterone, British Pharmacopoeia (BP) Reference Standard, Progesterone, powder, BioReagent, suitable for cell culture, Progesterone, European Pharmacopoeia (EP) Reference Standard, Progesterone, gamma-irradiated, BioXtra, suitable for cell culture, Progesterone, United States Pharmacopeia (USP) Reference Standard, Progesterone-Water Soluble, powder, BioReagent, suitable for cell culture, Progesterone for peak identification, European Pharmacopoeia (EP) Reference Standard, Progesterone for system suitability, European Pharmacopoeia (EP) Reference Standard, Progesterone, Pharmaceutical Secondary Standard, Certified Reference Material, (1S,2R,10S,11S,14S,15S)-14-acetyl-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-en-5-one, 137940-28-4
Bioactivity: -
Solubility in Different Solvents
| Solvent | Temperature [K] | Crystal form | Solubility [mg/mL] | Reference |
|---|---|---|---|---|
| 1,4-Dioxane | 288.15 | - | 242.9 | [270] |
| 1,4-Dioxane | 293.15 | - | 290.9 | [270] |
| 1,4-Dioxane | 298.15 | - | 343.1 | [270] |
| 1,4-Dioxane | 303.15 | - | 406.3 | [270] |
| 1,4-Dioxane | 308.15 | - | 481.1 | [270] |
| 1,4-Dioxane | 313.15 | - | 566.5 | [270] |
| 1,4-Dioxane | 318.15 | - | 663.1 | [270] |
| 1,4-Dioxane | 323.15 | - | 777.5 | [270] |
| 1-Butanol | 278.15 | - | 24.78 | [270] |
| 1-Butanol | 283.15 | - | 33.17 | [270] |
| 1-Butanol | 288.15 | - | 44.52 | [270] |
| 1-Butanol | 293.15 | - | 57.11 | [270] |
| 1-Butanol | 298.15 | - | 73.83 | [270] |
| 1-Butanol | 303.15 | - | 93.85 | [270] |
| 1-Butanol | 308.15 | - | 121.3 | [270] |
| 1-Butanol | 313.15 | - | 154.9 | [270] |
| 1-Butanol | 318.15 | - | 195.5 | [270] |
| 1-Butanol | 323.15 | - | 244.5 | [270] |
| 1-Propanol | 278.15 | - | 22.62 | [270] |
| 1-Propanol | 283.15 | - | 30.39 | [270] |
| 1-Propanol | 288.15 | - | 41.36 | [270] |
| 1-Propanol | 293.15 | - | 55.89 | [270] |
| 1-Propanol | 298.15 | - | 72.89 | [270] |
| 1-Propanol | 303.15 | - | 96.59 | [270] |
| 1-Propanol | 308.15 | - | 125.5 | [270] |
| 1-Propanol | 313.15 | - | 161.8 | [270] |
| 1-Propanol | 318.15 | - | 209.0 | [270] |
| 1-Propanol | 323.15 | - | 266.8 | [270] |
| Acetone | 278.15 | - | 63.34 | [270] |
| Acetone | 283.15 | - | 82.7 | [270] |
| Acetone | 288.15 | - | 107.8 | [270] |
| Acetone | 293.15 | - | 137.4 | [270] |
| Acetone | 298.15 | - | 175.5 | [270] |
| Acetone | 303.15 | - | 219.0 | [270] |
| Acetone | 308.15 | - | 275.4 | [270] |
| Acetone | 313.15 | - | 341.6 | [270] |
| Acetone | 318.15 | - | 427.7 | [270] |
| Acetone | 323.15 | - | 535.4 | [270] |
| Acetonitrile | 278.15 | - | 44.11 | [270] |
| Acetonitrile | 283.15 | - | 61.79 | [270] |
| Acetonitrile | 288.15 | - | 80.25 | [270] |
| Acetonitrile | 293.15 | - | 108.4 | [270] |
| Acetonitrile | 298.15 | - | 143.0 | [270] |
| Acetonitrile | 303.15 | - | 185.8 | [270] |
| Acetonitrile | 308.15 | - | 241.7 | [270] |
| Acetonitrile | 313.15 | - | 311.6 | [270] |
| Acetonitrile | 318.15 | - | 399.6 | [270] |
| Acetonitrile | 323.15 | - | 510.2 | [270] |
| Ethanol | 278.15 | - | 18.51 | [270] |
| Ethanol | 283.15 | - | 24.91 | [270] |
| Ethanol | 288.15 | - | 33.96 | [270] |
| Ethanol | 293.15 | - | 46.7 | [270] |
| Ethanol | 298.15 | - | 60.7 | [270] |
| Ethanol | 303.15 | - | 79.18 | [270] |
| Ethanol | 308.15 | - | 104.0 | [270] |
| Ethanol | 313.15 | - | 135.7 | [270] |
| Ethanol | 318.15 | - | 172.5 | [270] |
| Ethanol | 323.15 | - | 223.6 | [270] |
| Ethyl acetate | 278.15 | - | 47.11 | [270] |
| Ethyl acetate | 283.15 | - | 57.94 | [270] |
| Ethyl acetate | 288.15 | - | 70.98 | [270] |
| Ethyl acetate | 293.15 | - | 87.71 | [270] |
| Ethyl acetate | 298.15 | - | 105.7 | [270] |
| Ethyl acetate | 303.15 | - | 128.6 | [270] |
| Ethyl acetate | 308.15 | - | 155.5 | [270] |
| Ethyl acetate | 313.15 | - | 187.5 | [270] |
| Ethyl acetate | 318.15 | - | 223.4 | [270] |
| Ethyl acetate | 323.15 | - | 268.6 | [270] |
| Heptane | 278.15 | - | 0.2449 | [270] |
| Heptane | 283.15 | - | 0.3912 | [270] |
| Heptane | 288.15 | - | 0.607 | [270] |
| Heptane | 293.15 | - | 0.9126 | [270] |
| Heptane | 298.15 | - | 1.317 | [270] |
| Heptane | 303.15 | - | 1.939 | [270] |
| Heptane | 308.15 | - | 2.843 | [270] |
| Heptane | 313.15 | - | 4.149 | [270] |
| Heptane | 318.15 | - | 5.932 | [270] |
| Heptane | 323.15 | - | 8.336 | [270] |
| Isopropanol | 278.15 | - | 13.15 | [270] |
| Isopropanol | 283.15 | - | 18.61 | [270] |
| Isopropanol | 288.15 | - | 25.56 | [270] |
| Isopropanol | 293.15 | - | 34.86 | [270] |
| Isopropanol | 298.15 | - | 47.45 | [270] |
| Isopropanol | 303.15 | - | 63.05 | [270] |
| Isopropanol | 308.15 | - | 83.81 | [270] |
| Isopropanol | 313.15 | - | 111.3 | [270] |
| Isopropanol | 318.15 | - | 144.5 | [270] |
| Isopropanol | 323.15 | - | 189.3 | [270] |
| Methanol | 278.15 | - | 18.35 | [270] |
| Methanol | 283.15 | - | 26.41 | [270] |
| Methanol | 288.15 | - | 37.07 | [270] |
| Methanol | 293.15 | - | 52.84 | [270] |
| Methanol | 298.15 | - | 71.66 | [270] |
| Methanol | 303.15 | - | 98.96 | [270] |
| Methanol | 308.15 | - | 134.0 | [270] |
| Methanol | 313.15 | - | 181.3 | [270] |
| Methanol | 318.15 | - | 239.5 | [270] |
| Methanol | 323.15 | - | 321.6 | [270] |
| Tetrahydrofuran | 278.15 | - | 250.6 | [270] |
| Tetrahydrofuran | 283.15 | - | 295.5 | [270] |
| Tetrahydrofuran | 288.15 | - | 346.0 | [270] |
| Tetrahydrofuran | 293.15 | - | 403.0 | [270] |
| Tetrahydrofuran | 298.15 | - | 469.8 | [270] |
| Tetrahydrofuran | 303.15 | - | 546.2 | [270] |
| Tetrahydrofuran | 308.15 | - | 634.0 | [270] |
| Tetrahydrofuran | 313.15 | - | 735.1 | [270] |
| Tetrahydrofuran | 318.15 | - | 848.5 | [270] |
| Tetrahydrofuran | 323.15 | - | 984.9 | [270] |
| Toluene | 278.15 | - | 260.4 | [270] |
| Toluene | 283.15 | - | 298.2 | [270] |
| Toluene | 288.15 | - | 339.4 | [270] |
| Toluene | 293.15 | - | 385.4 | [270] |
| Toluene | 298.15 | - | 438.6 | [270] |
| Toluene | 303.15 | - | 500.3 | [270] |
| Toluene | 308.15 | - | 561.4 | [270] |
| Toluene | 313.15 | - | 646.2 | [270] |
| Toluene | 318.15 | - | 733.5 | [270] |
| Toluene | 323.15 | - | 830.8 | [270] |
Molecule 3D descriptors
| Descriptor | Value |
|---|---|
| PMI1 | 734.5976 |
| PMI2 | 3883.7007 |
| PMI3 | 4247.7719 |
| NPR1 | 0.1729 |
| NPR2 | 0.9143 |
| RadiusOfGyration | 3.7546 |
| InertialShapeFactor | 0.0012 |
| Eccentricity | 0.9849 |
| Asphericity | 0.5697 |
| SpherocityIndex | 0.2563 |
| PBF | 0.8686 |